CAS 133228-94-1 is the registry number for (2-Hydroxy-3-(4-nitrophenoxy)propyl)(methyl)amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(methylamino)-3-(4-nitrophenoxy)propan-2-ol (CAS 133228-94-1) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: 1-(methylamino)-3-(4-nitrophenoxy)propan-2-ol. InChIKey: VXKBHPFLIUMGNB-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1-(methylamino)-3-(4-nitrophenoxy)propan-2-ol |
| InChIKey | VXKBHPFLIUMGNB-UHFFFAOYSA-N |
| SMILES | CNCC(COC1=CC=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)