CAS 1332530-25-2 appears in our catalog under these names: 2-Imidazo[2,1-b][1,3]thiazol-6-ylbutanoic acid hydrochloride, 95%, 2-IMidazo(2,1-b)(1,3)thiazol-6-ylbutanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-imidazo[2,1-b][1,3]thiazol-6-ylbutanoic acid;hydrochloride (CAS 1332530-25-2) is a chemical compound with the molecular formula C9H11ClN2O2S and a molecular weight of 246.71 g/mol. IUPAC name: 2-imidazo[2,1-b][1,3]thiazol-6-ylbutanoic acid;hydrochloride. InChIKey: WWJFGKQZIPUGOL-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2-imidazo[2,1-b][1,3]thiazol-6-ylbutanoic acid;hydrochloride |
| InChIKey | WWJFGKQZIPUGOL-UHFFFAOYSA-N |
| SMILES | CCC(C1=CN2C=CSC2=N1)C(=O)O.Cl |
Computed by PubChem (NCBI)