CAS 494776-93-1 is the registry number for 4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)aniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline (CAS 494776-93-1) is a chemical compound with the molecular formula C9H11ClN2O2S and a molecular weight of 246.71 g/mol. IUPAC name: 4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline. InChIKey: LENKHMXJJDPDCS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 4-chloro-3-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline |
| InChIKey | LENKHMXJJDPDCS-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=C(C=CC(=C2)N)Cl |
Computed by PubChem (NCBI)