CAS 19580-41-7 is the registry number for (Z)-[Amino(thiophen-2-yl)methylidene]amino 4-chlorobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
[(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-chlorobutanoate (CAS 19580-41-7) is a chemical compound with the molecular formula C9H11ClN2O2S and a molecular weight of 246.71 g/mol. IUPAC name: [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-chlorobutanoate. InChIKey: GZVDRZSHXMCMKH-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | [(Z)-[amino(thiophen-2-yl)methylidene]amino] 4-chlorobutanoate |
| InChIKey | GZVDRZSHXMCMKH-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)/C(=N/OC(=O)CCCCl)/N |
Computed by PubChem (NCBI)