Products 60597-70-8
CAS 60597-70-8 is the registry number for 2-Chloro-3-(pyrrolidin-1-ylsulfonyl)pyridine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-chloro-3-pyrrolidin-1-ylsulfonylpyridine (CAS 60597-70-8) is a chemical compound with the molecular formula C9H11ClN2O2S and a molecular weight of 246.71 g/mol. IUPAC name: 2-chloro-3-pyrrolidin-1-ylsulfonylpyridine. InChIKey: BQNRIDNMAGXHAV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2-chloro-3-pyrrolidin-1-ylsulfonylpyridine |
| InChIKey | BQNRIDNMAGXHAV-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)