CAS 64614-51-3 appears in our catalog under these names: 2-Chloro-5-(pyrrolidine-1-sulfonyl)-pyridine, 95%, 2-Chloro-5-(pyrrolidine-1-sulfonyl)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
2-chloro-5-pyrrolidin-1-ylsulfonylpyridine (CAS 64614-51-3) is a chemical compound with the molecular formula C9H11ClN2O2S and a molecular weight of 246.71 g/mol. IUPAC name: 2-chloro-5-pyrrolidin-1-ylsulfonylpyridine. InChIKey: HBZKJCDPAUHBFB-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2S |
|---|---|
| Molecular weight | 246.71 g/mol |
| IUPAC name | 2-chloro-5-pyrrolidin-1-ylsulfonylpyridine |
| InChIKey | HBZKJCDPAUHBFB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)