CAS 1332747-46-2 is the registry number for 3-(3,5-Dichlorophenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(3,5-dichlorophenyl)benzonitrile (CAS 1332747-46-2) is a chemical compound with the molecular formula C13H7Cl2N and a molecular weight of 248.10 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)benzonitrile. InChIKey: HARYBHGSKGMXJG-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)benzonitrile |
| InChIKey | HARYBHGSKGMXJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC(=C2)Cl)Cl)C#N |
Computed by PubChem (NCBI)