Products 1355247-47-0
CAS 1355247-47-0 is the registry number for 2-Chloro-4-(3-chlorophenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-chloro-4-(3-chlorophenyl)benzonitrile (CAS 1355247-47-0) is a chemical compound with the molecular formula C13H7Cl2N and a molecular weight of 248.10 g/mol. IUPAC name: 2-chloro-4-(3-chlorophenyl)benzonitrile. InChIKey: UMRMTRVYHJFULT-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-chloro-4-(3-chlorophenyl)benzonitrile |
| InChIKey | UMRMTRVYHJFULT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)