Products 35547-70-7
CAS 35547-70-7 is the registry number for 6,9-Dichloroacridine. Offered by: TRC. Available pack sizes: 500mg.
3,9-dichloroacridine (CAS 35547-70-7) is a chemical compound with the molecular formula C13H7Cl2N and a molecular weight of 248.10 g/mol. IUPAC name: 3,9-dichloroacridine. InChIKey: AYTQPRSVTNMLIV-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 3,9-dichloroacridine |
| InChIKey | AYTQPRSVTNMLIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC(=CC3=N2)Cl)Cl |
Computed by PubChem (NCBI)