CAS 1352318-57-0 is the registry number for 2-(3,5-Dichlorophenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3,5-dichlorophenyl)benzonitrile (CAS 1352318-57-0) is a chemical compound with the molecular formula C13H7Cl2N and a molecular weight of 248.10 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)benzonitrile. InChIKey: NEXCBHABDVODHH-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)benzonitrile |
| InChIKey | NEXCBHABDVODHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)