CAS 38052-81-2 is the registry number for 2,6-Dichlorophenanthridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichlorophenanthridine (CAS 38052-81-2) is a chemical compound with the molecular formula C13H7Cl2N and a molecular weight of 248.10 g/mol. IUPAC name: 2,6-dichlorophenanthridine. InChIKey: BTISIQJTOTUWFG-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2N |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2,6-dichlorophenanthridine |
| InChIKey | BTISIQJTOTUWFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3)Cl)N=C2Cl |
Computed by PubChem (NCBI)