CAS 1332886-41-5 is the registry number for tert-Butyl N-{1-[(4-chlorophenyl)carbonyl]cyclopropyl}carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-[1-(4-chlorobenzoyl)cyclopropyl]carbamate (CAS 1332886-41-5) is a chemical compound with the molecular formula C15H18ClNO3 and a molecular weight of 295.76 g/mol. IUPAC name: tert-butyl N-[1-(4-chlorobenzoyl)cyclopropyl]carbamate. InChIKey: NAMLTLGYEMGHKR-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO3 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | tert-butyl N-[1-(4-chlorobenzoyl)cyclopropyl]carbamate |
| InChIKey | NAMLTLGYEMGHKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)