CAS 852217-75-5 is the registry number for 1-(Chloroacetyl)-2-(3,4-dihydro-2h-1,5-benzodioxepin-7-yl)pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]ethanone (CAS 852217-75-5) is a chemical compound with the molecular formula C15H18ClNO3 and a molecular weight of 295.76 g/mol. IUPAC name: 2-chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]ethanone. InChIKey: FDEJYVYKKSGDOH-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO3 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | 2-chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)pyrrolidin-1-yl]ethanone |
| InChIKey | FDEJYVYKKSGDOH-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)CCl)C2=CC3=C(C=C2)OCCCO3 |
Computed by PubChem (NCBI)