Products 2760566-47-8
CAS 2760566-47-8 is the registry number for rel-Methyl 2-((2S,5R)-2-(3-chlorophenyl)-5-methylpiperidin-1-yl)-2-oxoacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(2S,5R)-2-(3-chlorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate (CAS 2760566-47-8) is a chemical compound with the molecular formula C15H18ClNO3 and a molecular weight of 295.76 g/mol. IUPAC name: methyl 2-[(2S,5R)-2-(3-chlorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate. InChIKey: KRSZBGSKULFQAS-MFKMUULPSA-N.
| Molecular formula | C15H18ClNO3 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | methyl 2-[(2S,5R)-2-(3-chlorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetate |
| InChIKey | KRSZBGSKULFQAS-MFKMUULPSA-N |
| SMILES | C[C@@H]1CC[C@H](N(C1)C(=O)C(=O)OC)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)