CAS 2383664-97-7 is the registry number for tert-Butyl 7-chloro-5-oxo-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carboxylate (CAS 2383664-97-7) is a chemical compound with the molecular formula C15H18ClNO3 and a molecular weight of 295.76 g/mol. IUPAC name: tert-butyl 7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carboxylate. InChIKey: QWWHJFBKRCXKFP-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO3 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | tert-butyl 7-chloro-5-oxo-3,4-dihydro-2H-1-benzazepine-1-carboxylate |
| InChIKey | QWWHJFBKRCXKFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=O)C2=C1C=CC(=C2)Cl |
Computed by PubChem (NCBI)