Products 309736-60-5

CAS 309736-60-5 is the registry number for 2-((3-Chloro-4-methylphenyl)carbamoyl)cyclohexane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3-chloro-4-methylphenyl)carbamoyl]cyclohexane-1-carboxylic acid (CAS 309736-60-5) is a chemical compound with the molecular formula C15H18ClNO3 and a molecular weight of 295.76 g/mol. IUPAC name: 2-[(3-chloro-4-methylphenyl)carbamoyl]cyclohexane-1-carboxylic acid. InChIKey: KOOIZLHXFSOYRX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18ClNO3
Molecular weight295.76 g/mol
IUPAC name2-[(3-chloro-4-methylphenyl)carbamoyl]cyclohexane-1-carboxylic acid
InChIKeyKOOIZLHXFSOYRX-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NC(=O)C2CCCCC2C(=O)O)Cl

Computed by PubChem (NCBI)