Products 1333083-66-1
CAS 1333083-66-1 appears in our catalog under these names: 5-fluoro-2-(methoxymethyl)phenylboronic acid, 95%, (5-fluoro-2-(methoxymethyl)phenyl)boronic acid, 98+%, 5–Fluoro–2–(methoxymethyl)phenylboronic acid, 5-Fluoro-2-(methoxymethyl)phenylboronic acid, 95%, 95%, (5-Fluoro-2-(methoxymethyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[5-fluoro-2-(methoxymethyl)phenyl]boronic acid (CAS 1333083-66-1) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: [5-fluoro-2-(methoxymethyl)phenyl]boronic acid. InChIKey: ZPWWSXGVWWPNHR-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | [5-fluoro-2-(methoxymethyl)phenyl]boronic acid |
| InChIKey | ZPWWSXGVWWPNHR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)COC)(O)O |
Computed by PubChem (NCBI)