CAS 133409-72-0 is the registry number for (E)-2-(2-(Bromomethyl)phenyl)-2-(methoxyimino)acetic Acid Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 250mg, 25mg.
Methyl (2E)-2-[2-(bromomethyl)phenyl]-2-methoxyiminoacetate (CAS 133409-72-0) is a chemical compound with the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. IUPAC name: methyl (2E)-2-[2-(bromomethyl)phenyl]-2-methoxyiminoacetate. InChIKey: LDPXOYHMGOQPIV-JLHYYAGUSA-N.
| Molecular formula | C11H12BrNO3 |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | methyl (2E)-2-[2-(bromomethyl)phenyl]-2-methoxyiminoacetate |
| InChIKey | LDPXOYHMGOQPIV-JLHYYAGUSA-N |
| SMILES | COC(=O)/C(=N/OC)/C1=CC=CC=C1CBr |
Computed by PubChem (NCBI)