Products 1334221-11-2
CAS 1334221-11-2 is the registry number for (2-ethoxy-4,6-dimethylphenyl)boronic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-ethoxy-4,6-dimethylphenyl)boronic acid (CAS 1334221-11-2) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (2-ethoxy-4,6-dimethylphenyl)boronic acid. InChIKey: UVUCIDJRTGOSND-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (2-ethoxy-4,6-dimethylphenyl)boronic acid |
| InChIKey | UVUCIDJRTGOSND-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OCC)C)C)(O)O |
Computed by PubChem (NCBI)