Products 1334305-03-1
CAS 1334305-03-1 is the registry number for 5,6-Dimethyl-1-benzofuran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6-dimethyl-1-benzofuran-3-carboxylic acid (CAS 1334305-03-1) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 5,6-dimethyl-1-benzofuran-3-carboxylic acid. InChIKey: KDMLAYXNCVXDOM-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 5,6-dimethyl-1-benzofuran-3-carboxylic acid |
| InChIKey | KDMLAYXNCVXDOM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC=C2C(=O)O |
Computed by PubChem (NCBI)