Products 1334499-55-6
CAS 1334499-55-6 appears in our catalog under these names: 9-Chloro-3,4-dihydro-1h-benzo[e][1,4]diazepine-2,5-dione, 95%, 9-chloro-3,4-dihydro-1H-benzo(e)(1,4)diazepine-2,5-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
9-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 1334499-55-6) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 9-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: PUDRJONOIGUBCU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 9-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | PUDRJONOIGUBCU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC=C2Cl)C(=O)N1 |
Computed by PubChem (NCBI)