CAS 1334499-99-8 is the registry number for Methyl 1-(benzenesulfonyl)azetidine-3-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 1-(benzenesulfonyl)azetidine-3-carboxylate (CAS 1334499-99-8) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: methyl 1-(benzenesulfonyl)azetidine-3-carboxylate. InChIKey: RJQDUKAKDSLZDL-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | methyl 1-(benzenesulfonyl)azetidine-3-carboxylate |
| InChIKey | RJQDUKAKDSLZDL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CN(C1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)