CAS 13345-23-8 is the registry number for 1-Hydroxybenzo(a)pyrene. Offered by: TRC. Available pack sizes: 100mg.
Benzo[a]pyren-1-ol (CAS 13345-23-8) is a chemical compound with the molecular formula C20H12O and a molecular weight of 268.3 g/mol. IUPAC name: benzo[a]pyren-1-ol. InChIKey: GPIRWWPRDKGKPS-UHFFFAOYSA-N.
| Molecular formula | C20H12O |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | benzo[a]pyren-1-ol |
| InChIKey | GPIRWWPRDKGKPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3=C4C(=CC2=C1)C=CC5=C4C(=C(C=C5)O)C=C3 |
Computed by PubChem (NCBI)