CAS 85319-78-4 is the registry number for Benz(l)aceanthrylen-1(2H)-one. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
Pentacyclo[11.6.1.02,11.03,8.017,20]icosa-1(20),2(11),3,5,7,9,12,14,16-nonaen-19-one (CAS 85319-78-4) is a chemical compound with the molecular formula C20H12O and a molecular weight of 268.3 g/mol. IUPAC name: pentacyclo[11.6.1.02,11.03,8.017,20]icosa-1(20),2(11),3,5,7,9,12,14,16-nonaen-19-one. InChIKey: SIBORPGRNXOSIH-UHFFFAOYSA-N.
| Molecular formula | C20H12O |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | pentacyclo[11.6.1.02,11.03,8.017,20]icosa-1(20),2(11),3,5,7,9,12,14,16-nonaen-19-one |
| InChIKey | SIBORPGRNXOSIH-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC3=CC4=C(C5=CC=CC=C5C=C4)C(=C23)C1=O |
Computed by PubChem (NCBI)