CAS 239-69-0 appears in our catalog under these names: Dinaphtho[1,2-b:2',1'-d]furan, 95%, Dinaphtho(1,2-b:2',1'-d)furan, 97%, Dinaphtho(1,2–b:2',1'–d)furan, Dinaphtho[1,2-b:2',1'-d]furan, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (CAS 239-69-0) is a chemical compound with the molecular formula C20H12O and a molecular weight of 268.3 g/mol. IUPAC name: 12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene. InChIKey: YBJNAFSCQYGLMU-UHFFFAOYSA-N.
| Molecular formula | C20H12O |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 12-oxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| InChIKey | YBJNAFSCQYGLMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2OC4=C3C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)