CAS 242-51-3 appears in our catalog under these names: dinaphtho(2,3–b:2',3'–d)furan, Dinaphtho[2,3-b:2',3'-d]furan, 95%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-alt-(9-hexyl-3,6-carbazole)), dinaphtho[2,3-b:2',3'-d]furan, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Lumtec, Chemat. Available pack sizes: 25mg, 5mg, 100mg, 250mg, On request.
12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene (CAS 242-51-3) is a chemical compound with the molecular formula C20H12O and a molecular weight of 268.3 g/mol. IUPAC name: 12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene. InChIKey: BOCFGAMKSYQRCI-UHFFFAOYSA-N.
| Molecular formula | C20H12O |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 12-oxapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,13,15,17,19-decaene |
| InChIKey | BOCFGAMKSYQRCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=CC5=CC=CC=C5C=C4O3 |
Computed by PubChem (NCBI)