Products 194-63-8
CAS 194-63-8 appears in our catalog under these names: Dinaphtho[2,1-b:1',2'-d]furan, 95%, Dinaphtho(2,1-b:1',2'-d)furan, Dinaphtho(2,1–b：1',2'–d)furan, Dinaphtho[2,1-b:1',2'-d]furan, >98.0%(GC), Dinaphtho[2,1-b:1',2'-d]furan 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (CAS 194-63-8) is a chemical compound with the molecular formula C20H12O and a molecular weight of 268.3 g/mol. IUPAC name: 12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene. InChIKey: QIMOZEUDRUTIBS-UHFFFAOYSA-N.
| Molecular formula | C20H12O |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| InChIKey | QIMOZEUDRUTIBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)