CAS 1334547-61-3 is the registry number for Apomorphine Phenanthrene Dione. Offered by: TRC. Available pack sizes: 10mg.
8-[2-(methylamino)ethyl]phenanthrene-3,4-dione (CAS 1334547-61-3) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: 8-[2-(methylamino)ethyl]phenanthrene-3,4-dione. InChIKey: XARFTOZXPPODOO-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | 8-[2-(methylamino)ethyl]phenanthrene-3,4-dione |
| InChIKey | XARFTOZXPPODOO-UHFFFAOYSA-N |
| SMILES | CNCCC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C=C3 |
Computed by PubChem (NCBI)