Products 1334598-61-6
CAS 1334598-61-6 is the registry number for Methyl 5-(3,4-dimethoxyphenyl)-2-methyl-3-furancarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 5-(3,4-dimethoxyphenyl)-2-methylfuran-3-carboxylate (CAS 1334598-61-6) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: methyl 5-(3,4-dimethoxyphenyl)-2-methylfuran-3-carboxylate. InChIKey: YKHHODXWMRHECF-UHFFFAOYSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | methyl 5-(3,4-dimethoxyphenyl)-2-methylfuran-3-carboxylate |
| InChIKey | YKHHODXWMRHECF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C2=CC(=C(C=C2)OC)OC)C(=O)OC |
Computed by PubChem (NCBI)