CAS 13349-91-2 appears in our catalog under these names: 1–(2,2,2–Trifluoroethyl)piperazine dihydrochloride, 1-(2,2,2-Trifluoroethyl)piperazine dihydrochloride, 95%, 95%, 1-(2,2,2-Trifluoroethyl)piperazine dihydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g, 25g, 10g.
1-(2,2,2-trifluoroethyl)piperazine;dihydrochloride (CAS 13349-91-2) is a chemical compound with the molecular formula C6H13Cl2F3N2 and a molecular weight of 241.08 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)piperazine;dihydrochloride. InChIKey: FZNSAOHSKTXHEJ-UHFFFAOYSA-N.
| Molecular formula | C6H13Cl2F3N2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)piperazine;dihydrochloride |
| InChIKey | FZNSAOHSKTXHEJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)