CAS 1803560-89-5 is the registry number for 4-(Trifluoromethyl)piperidin-4-amine diHCl. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(trifluoromethyl)piperidin-4-amine;dihydrochloride (CAS 1803560-89-5) is a chemical compound with the molecular formula C6H13Cl2F3N2 and a molecular weight of 241.08 g/mol. IUPAC name: 4-(trifluoromethyl)piperidin-4-amine;dihydrochloride. InChIKey: WZJWTZFLFZBCEO-UHFFFAOYSA-N.
| Molecular formula | C6H13Cl2F3N2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 4-(trifluoromethyl)piperidin-4-amine;dihydrochloride |
| InChIKey | WZJWTZFLFZBCEO-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)