CAS 2705510-84-3 is the registry number for (R)-1-(2,2,2-Trifluoroethyl)pyrrolidin-3-amine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine;dihydrochloride (CAS 2705510-84-3) is a chemical compound with the molecular formula C6H13Cl2F3N2 and a molecular weight of 241.08 g/mol. IUPAC name: (3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine;dihydrochloride. InChIKey: QRYMVOXOYVAWEK-ZJIMSODOSA-N.
| Molecular formula | C6H13Cl2F3N2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | (3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-amine;dihydrochloride |
| InChIKey | QRYMVOXOYVAWEK-ZJIMSODOSA-N |
| SMILES | C1CN(C[C@@H]1N)CC(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)