CAS 2138136-32-8 appears in our catalog under these names: N1-(2,2,2-Trifluoroethyl)cyclobutane-1,3-diamine dihydrochloride, 95%, N1-(2,2,2-Trifluoroethyl)cyclobutane-1,3-diamine dihydrochloride, somers. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-N-(2,2,2-trifluoroethyl)cyclobutane-1,3-diamine;dihydrochloride (CAS 2138136-32-8) is a chemical compound with the molecular formula C6H13Cl2F3N2 and a molecular weight of 241.08 g/mol. IUPAC name: 1-N-(2,2,2-trifluoroethyl)cyclobutane-1,3-diamine;dihydrochloride. InChIKey: IYDQILWTIKETTG-UHFFFAOYSA-N.
| Molecular formula | C6H13Cl2F3N2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 1-N-(2,2,2-trifluoroethyl)cyclobutane-1,3-diamine;dihydrochloride |
| InChIKey | IYDQILWTIKETTG-UHFFFAOYSA-N |
| SMILES | C1C(CC1NCC(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)