CAS 2741689-43-8 is the registry number for Rel-(2R,4S)-2-(trifluoromethyl)piperidin-4-amine dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2S,4R)-2-(trifluoromethyl)piperidin-4-amine;dihydrochloride (CAS 2741689-43-8) is a chemical compound with the molecular formula C6H13Cl2F3N2 and a molecular weight of 241.08 g/mol. IUPAC name: (2S,4R)-2-(trifluoromethyl)piperidin-4-amine;dihydrochloride. InChIKey: NPLFPFRWIIGLHP-CIFXRNLBSA-N.
| Molecular formula | C6H13Cl2F3N2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | (2S,4R)-2-(trifluoromethyl)piperidin-4-amine;dihydrochloride |
| InChIKey | NPLFPFRWIIGLHP-CIFXRNLBSA-N |
| SMILES | C1CN[C@@H](C[C@@H]1N)C(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)