CAS 1335042-83-5 is the registry number for 3-(Boc-(NH)-4-Cl-3-Me-butanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.
4-chloro-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1335042-83-5) is a chemical compound with the molecular formula C10H18ClNO4 and a molecular weight of 251.71 g/mol. IUPAC name: 4-chloro-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VTAGTRVHFWPTKV-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO4 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 4-chloro-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VTAGTRVHFWPTKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(CC(=O)O)CCl |
Computed by PubChem (NCBI)