Products 1335042-83-5

CAS 1335042-83-5 is the registry number for 3-(Boc-(NH)-4-Cl-3-Me-butanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-chloro-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1335042-83-5) is a chemical compound with the molecular formula C10H18ClNO4 and a molecular weight of 251.71 g/mol. IUPAC name: 4-chloro-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VTAGTRVHFWPTKV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClNO4
Molecular weight251.71 g/mol
IUPAC name4-chloro-3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
InChIKeyVTAGTRVHFWPTKV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(C)(CC(=O)O)CCl

Computed by PubChem (NCBI)