CAS 2375248-07-8 is the registry number for rac-Methyl 2-((3R,4R)-4-(2-methoxy-2-oxoethyl)pyrrolidin-3-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-[(3S,4S)-4-(2-methoxy-2-oxoethyl)pyrrolidin-3-yl]acetate;hydrochloride (CAS 2375248-07-8) is a chemical compound with the molecular formula C10H18ClNO4 and a molecular weight of 251.71 g/mol. IUPAC name: methyl 2-[(3S,4S)-4-(2-methoxy-2-oxoethyl)pyrrolidin-3-yl]acetate;hydrochloride. InChIKey: ARFAOEDZKFQMMM-SCLLHFNJSA-N.
| Molecular formula | C10H18ClNO4 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | methyl 2-[(3S,4S)-4-(2-methoxy-2-oxoethyl)pyrrolidin-3-yl]acetate;hydrochloride |
| InChIKey | ARFAOEDZKFQMMM-SCLLHFNJSA-N |
| SMILES | COC(=O)C[C@@H]1CNC[C@H]1CC(=O)OC.Cl |
Computed by PubChem (NCBI)