CAS 150109-48-1 appears in our catalog under these names: Chloromethyl 2-(((tert-butoxy)carbonyl)amino)-2-methylpropanoate, 95%, Chloromethyl 2-(((tert-butoxy)carbonyl)amino)-2-methylpropanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Chloromethyl 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 150109-48-1) is a chemical compound with the molecular formula C10H18ClNO4 and a molecular weight of 251.71 g/mol. IUPAC name: chloromethyl 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: ZVIVWDWVAWCELW-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO4 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | chloromethyl 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | ZVIVWDWVAWCELW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)OCCl |
Computed by PubChem (NCBI)