Products 2059917-33-6
CAS 2059917-33-6 is the registry number for rac-2,5-Diethyl (2R,5R)-Pyrrolidine-2,5-dicarboxylate Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
Diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride (CAS 2059917-33-6) is a chemical compound with the molecular formula C10H18ClNO4 and a molecular weight of 251.71 g/mol. IUPAC name: diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride. InChIKey: IAUFBLCQRNNJLX-SCLLHFNJSA-N.
| Molecular formula | C10H18ClNO4 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | diethyl (2R,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride |
| InChIKey | IAUFBLCQRNNJLX-SCLLHFNJSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](N1)C(=O)OCC.Cl |
Computed by PubChem (NCBI)