CAS 162376-17-2 appears in our catalog under these names: Rel-diethyl (2S,5R)-pyrrolidine-2,5-dicarboxylate hydrochloride, 98%, rac-2,5-Diethyl (2R,5S)-pyrrolidine-2,5-dicarboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Diethyl (2S,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride (CAS 162376-17-2) is a chemical compound with the molecular formula C10H18ClNO4 and a molecular weight of 251.71 g/mol. IUPAC name: diethyl (2S,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride. InChIKey: IAUFBLCQRNNJLX-KVZVIFLMSA-N.
| Molecular formula | C10H18ClNO4 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | diethyl (2S,5R)-pyrrolidine-2,5-dicarboxylate;hydrochloride |
| InChIKey | IAUFBLCQRNNJLX-KVZVIFLMSA-N |
| SMILES | CCOC(=O)[C@H]1CC[C@H](N1)C(=O)OCC.Cl |
Computed by PubChem (NCBI)