CAS 1335140-32-3 is the registry number for 5-Methanesulfonyl-1,2-dimethyl-3-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,2-dimethyl-5-methylsulfonyl-3-nitrobenzene (CAS 1335140-32-3) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 1,2-dimethyl-5-methylsulfonyl-3-nitrobenzene. InChIKey: HAGDXUCBVIDYTM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 1,2-dimethyl-5-methylsulfonyl-3-nitrobenzene |
| InChIKey | HAGDXUCBVIDYTM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)