Products 133550-32-0
CAS 133550-32-0 appears in our catalog under these names: Tyrphostin B44, (-) enantiomer, Tyrphostin B44, (–) enantiomer. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 10mg, 50mg.
(E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide (CAS 133550-32-0) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide. InChIKey: UMGQVUWXNOJOSJ-KMHUVPDISA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide |
| InChIKey | UMGQVUWXNOJOSJ-KMHUVPDISA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=CC(=C(C=C2)O)O)/C#N |
Computed by PubChem (NCBI)