CAS 1335835-93-2 is the registry number for (2R,5R)-5-(2,3-Dihydro-1H-inden-4-yl)pyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-5-(2,3-dihydro-1H-inden-4-yl)pyrrolidine-2-carboxylic acid (CAS 1335835-93-2) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: (2R,5R)-5-(2,3-dihydro-1H-inden-4-yl)pyrrolidine-2-carboxylic acid. InChIKey: IOGDKNPGWWWNEX-CHWSQXEVSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2R,5R)-5-(2,3-dihydro-1H-inden-4-yl)pyrrolidine-2-carboxylic acid |
| InChIKey | IOGDKNPGWWWNEX-CHWSQXEVSA-N |
| SMILES | C1CC2=C(C1)C(=CC=C2)[C@H]3CC[C@@H](N3)C(=O)O |
Computed by PubChem (NCBI)