CAS 13372-41-3 appears in our catalog under these names: 1-tert-Butyl-4-(1-chloroethyl)benzene, 95%, 1-tert-butyl-4-(1-chloroethyl)benzene. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
1-tert-butyl-4-(1-chloroethyl)benzene (CAS 13372-41-3) is a chemical compound with the molecular formula C12H17Cl and a molecular weight of 196.71 g/mol. IUPAC name: 1-tert-butyl-4-(1-chloroethyl)benzene. InChIKey: CVOBIOVONMMYGZ-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl |
|---|---|
| Molecular weight | 196.71 g/mol |
| IUPAC name | 1-tert-butyl-4-(1-chloroethyl)benzene |
| InChIKey | CVOBIOVONMMYGZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(C)(C)C)Cl |
Computed by PubChem (NCBI)