CAS 28162-11-0 appears in our catalog under these names: alpha–Chloro–4–(tert–pentyl)toluene, 1-(Chloromethyl)-4-(tert-pentyl)benzene 90%, 1-(Chloromethyl)-4-(tert-pentyl)benzene, 90%(GC-MS),RG. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
1-(chloromethyl)-4-(2-methylbutan-2-yl)benzene (CAS 28162-11-0) is a chemical compound with the molecular formula C12H17Cl and a molecular weight of 196.71 g/mol. IUPAC name: 1-(chloromethyl)-4-(2-methylbutan-2-yl)benzene. InChIKey: GZSVKIJGGVPFGX-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl |
|---|---|
| Molecular weight | 196.71 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(2-methylbutan-2-yl)benzene |
| InChIKey | GZSVKIJGGVPFGX-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)CCl |
Computed by PubChem (NCBI)