CAS 484-65-1 appears in our catalog under these names: 2,3,4,5,6-Pentamethylbenzyl chloride, 95%, 2,3,4,5,6-Pentamethylbenzyl Chloride, >98.0%(GC), 2,3,4,5,6-Pentamethylbenzyl Chloride, 96%+(GC-MS),RG, 96%+(GC-MS),RG, 2,3,4,5,6-PENTAMETHYLBENZYL CHLORIDE, 96%+(GC-MS),RG. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
1-(chloromethyl)-2,3,4,5,6-pentamethylbenzene (CAS 484-65-1) is a chemical compound with the molecular formula C12H17Cl and a molecular weight of 196.71 g/mol. IUPAC name: 1-(chloromethyl)-2,3,4,5,6-pentamethylbenzene. InChIKey: CXUAEBDTJFKMBV-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl |
|---|---|
| Molecular weight | 196.71 g/mol |
| IUPAC name | 1-(chloromethyl)-2,3,4,5,6-pentamethylbenzene |
| InChIKey | CXUAEBDTJFKMBV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)CCl)C)C |
Computed by PubChem (NCBI)