CAS 54845-36-2 is the registry number for 2-chloro-1,3-diisopropylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-1,3-di(propan-2-yl)benzene (CAS 54845-36-2) is a chemical compound with the molecular formula C12H17Cl and a molecular weight of 196.71 g/mol. IUPAC name: 2-chloro-1,3-di(propan-2-yl)benzene. InChIKey: JQFVRQDQQXRLBG-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl |
|---|---|
| Molecular weight | 196.71 g/mol |
| IUPAC name | 2-chloro-1,3-di(propan-2-yl)benzene |
| InChIKey | JQFVRQDQQXRLBG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)Cl |
Computed by PubChem (NCBI)