CAS 1337915-73-7 is the registry number for 6,7-Dichloroisochromane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-3,4-dihydro-1H-isochromene (CAS 1337915-73-7) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 6,7-dichloro-3,4-dihydro-1H-isochromene. InChIKey: BIYKJZQNSPVCAI-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 6,7-dichloro-3,4-dihydro-1H-isochromene |
| InChIKey | BIYKJZQNSPVCAI-UHFFFAOYSA-N |
| SMILES | C1COCC2=CC(=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)