Products 133793-08-5
CAS 133793-08-5 is the registry number for Benzyl 3-(4-chlorophenyl)acrylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (E)-3-(4-chlorophenyl)prop-2-enoate (CAS 133793-08-5) is a chemical compound with the molecular formula C16H13ClO2 and a molecular weight of 272.72 g/mol. IUPAC name: benzyl (E)-3-(4-chlorophenyl)prop-2-enoate. InChIKey: XHTKVFJPIFRPOF-DHZHZOJOSA-N.
| Molecular formula | C16H13ClO2 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | benzyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | XHTKVFJPIFRPOF-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)/C=C/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzyl 3-(4-chlorophenyl)acrylate