CAS 1428936-75-7 is the registry number for (R)-Fluorenylethylchloroformate. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-1-(9H-fluoren-9-yl)ethyl] carbonochloridate (CAS 1428936-75-7) is a chemical compound with the molecular formula C16H13ClO2 and a molecular weight of 272.72 g/mol. IUPAC name: [(1R)-1-(9H-fluoren-9-yl)ethyl] carbonochloridate. InChIKey: SFRVOKMRHPQYGE-SNVBAGLBSA-N.
| Molecular formula | C16H13ClO2 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | [(1R)-1-(9H-fluoren-9-yl)ethyl] carbonochloridate |
| InChIKey | SFRVOKMRHPQYGE-SNVBAGLBSA-N |
| SMILES | C[C@H](C1C2=CC=CC=C2C3=CC=CC=C13)OC(=O)Cl |
Computed by PubChem (NCBI)