Products 52182-34-0
CAS 52182-34-0 is the registry number for 3-(3-Chlorophenyl)-1-(p-tolyl)prop-2-en-1-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(3-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one (CAS 52182-34-0) is a chemical compound with the molecular formula C16H13ClO2 and a molecular weight of 272.72 g/mol. IUPAC name: (E)-3-(3-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: UNNQBOJITJAFMT-BJMVGYQFSA-N.
| Molecular formula | C16H13ClO2 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | (E)-3-(3-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | UNNQBOJITJAFMT-BJMVGYQFSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)/C=C/C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)